CAS 137582-02-6 is the registry number for N-(3-(3-Methyl-5-sulfanyl-4H-1,2,4-triazol-4-yl)phenyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 10g.
N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]acetamide (CAS 137582-02-6) is a chemical compound with the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. IUPAC name: N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]acetamide. InChIKey: ATRHYXVKJVZTTH-UHFFFAOYSA-N.
| Molecular formula | C11H12N4OS |
|---|---|
| Molecular weight | 248.31 g/mol |
| IUPAC name | N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]acetamide |
| InChIKey | ATRHYXVKJVZTTH-UHFFFAOYSA-N |
| SMILES | CC1=NNC(=S)N1C2=CC=CC(=C2)NC(=O)C |
Computed by PubChem (NCBI)