Products 693219-71-5
CAS 693219-71-5 is the registry number for N-(4-Ethylpyridin-2-yl)-4-methyl-1,2,3-thiadiazole-5-carboxamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-ethyl-2-pyridinyl)-4-methylthiadiazole-5-carboxamide (CAS 693219-71-5) is a chemical compound with the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. IUPAC name: N-(4-ethyl-2-pyridinyl)-4-methylthiadiazole-5-carboxamide. InChIKey: SNZVPBVXZDQBCK-UHFFFAOYSA-N.
| Molecular formula | C11H12N4OS |
|---|---|
| Molecular weight | 248.31 g/mol |
| IUPAC name | N-(4-ethyl-2-pyridinyl)-4-methylthiadiazole-5-carboxamide |
| InChIKey | SNZVPBVXZDQBCK-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=NC=C1)NC(=O)C2=C(N=NS2)C |
Computed by PubChem (NCBI)