CAS 137583-04-1 appears in our catalog under these names: N1-(quinolin-2-yl)ethane-1,2-diamine, 98%, N-(2-Aminoethyl)quinolin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 100mg.
N'-quinolin-2-ylethane-1,2-diamine (CAS 137583-04-1) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: N'-quinolin-2-ylethane-1,2-diamine. InChIKey: ZETBPZAUNUEYSV-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | N'-quinolin-2-ylethane-1,2-diamine |
| InChIKey | ZETBPZAUNUEYSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)NCCN |
Computed by PubChem (NCBI)