CAS 1376614-99-1 appears in our catalog under these names: ent-Ezetimibe 99%, ent-Ezetimibe, Ezetimibe Impurity F, ent-Ezetimibe, >95% (HPLC), ent-Ezetimibe/ 98.3% (existing batch purity). Offered by: Ambeed, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 100mg, on request, 5mg, 1mg, 200mg.
(3S,4R)-1-(4-fluorophenyl)-3-[(3R)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one (CAS 1376614-99-1) is a chemical compound with the molecular formula C24H21F2NO3 and a molecular weight of 409.4 g/mol. IUPAC name: (3S,4R)-1-(4-fluorophenyl)-3-[(3R)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one. InChIKey: OLNTVTPDXPETLC-ZRBLBEILSA-N.
| Molecular formula | C24H21F2NO3 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | (3S,4R)-1-(4-fluorophenyl)-3-[(3R)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one |
| InChIKey | OLNTVTPDXPETLC-ZRBLBEILSA-N |
| SMILES | C1=CC(=CC=C1[C@H]2[C@@H](C(=O)N2C3=CC=C(C=C3)F)CC[C@H](C4=CC=C(C=C4)F)O)O |
Computed by PubChem (NCBI)