CAS 1296129-15-1 appears in our catalog under these names: Ezetimibe Impurity 56 (Tetrahydropyran Impurity), Ezetimibe Tetrahydropyran Impurity, >95% (HPLC), Ezetimibe Tetrahydropyran Impurity, Ezetimibe Tetrahydropyran Impurity 97%, EZETIMIBE TETRAHYDROPYRAN ANALOG. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 50mg, 5mg, 100mg, 25mg, 250mg, 1g.
(2R,3R,6S)-N,6-bis(4-fluorophenyl)-2-(4-hydroxyphenyl)oxane-3-carboxamide (CAS 1296129-15-1) is a chemical compound with the molecular formula C24H21F2NO3 and a molecular weight of 409.4 g/mol. IUPAC name: (2R,3R,6S)-N,6-bis(4-fluorophenyl)-2-(4-hydroxyphenyl)oxane-3-carboxamide. InChIKey: IBDXWUJVRNPFPE-VJBWXMMDSA-N.
| Molecular formula | C24H21F2NO3 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | (2R,3R,6S)-N,6-bis(4-fluorophenyl)-2-(4-hydroxyphenyl)oxane-3-carboxamide |
| InChIKey | IBDXWUJVRNPFPE-VJBWXMMDSA-N |
| SMILES | C1C[C@H](O[C@H]([C@@H]1C(=O)NC2=CC=C(C=C2)F)C3=CC=C(C=C3)O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)