CAS 1377576-66-3 is the registry number for 2-Bromo-5-phenyl-5H-benzofuro[3,2-c]carbazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-phenyl-[1]benzofuro[3,2-c]carbazole (CAS 1377576-66-3) is a chemical compound with the molecular formula C24H14BrNO and a molecular weight of 412.3 g/mol. IUPAC name: 2-bromo-5-phenyl-[1]benzofuro[3,2-c]carbazole. InChIKey: LGXVWYXWGYHARZ-UHFFFAOYSA-N.
| Molecular formula | C24H14BrNO |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | 2-bromo-5-phenyl-[1]benzofuro[3,2-c]carbazole |
| InChIKey | LGXVWYXWGYHARZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)Br)C4=C2C=CC5=C4OC6=CC=CC=C56 |
Computed by PubChem (NCBI)