CAS 1613325-84-0 is the registry number for 3-Bromo-9-(dibenzo[b,d]furan-3-yl)-9H-carbazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-9-dibenzofuran-3-ylcarbazole (CAS 1613325-84-0) is a chemical compound with the molecular formula C24H14BrNO and a molecular weight of 412.3 g/mol. IUPAC name: 3-bromo-9-dibenzofuran-3-ylcarbazole. InChIKey: CULYPLGBLNKMNY-UHFFFAOYSA-N.
| Molecular formula | C24H14BrNO |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | 3-bromo-9-dibenzofuran-3-ylcarbazole |
| InChIKey | CULYPLGBLNKMNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2C4=CC5=C(C=C4)C6=CC=CC=C6O5)C=CC(=C3)Br |
Computed by PubChem (NCBI)