Products 137786-94-8

CAS 137786-94-8 appears in our catalog under these names: Belamcandol B (contains up to 20% trans isomer), Belamcandol B. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

3-methoxy-5-[(Z)-pentadec-10-enyl]phenol (CAS 137786-94-8) is a chemical compound with the molecular formula C22H36O2 and a molecular weight of 332.5 g/mol. IUPAC name: 3-methoxy-5-[(Z)-pentadec-10-enyl]phenol. InChIKey: NKOPRUNFJQCUCF-SREVYHEPSA-N.

Identity
Molecular formulaC22H36O2
Molecular weight332.5 g/mol
IUPAC name3-methoxy-5-[(Z)-pentadec-10-enyl]phenol
InChIKeyNKOPRUNFJQCUCF-SREVYHEPSA-N
SMILESCCCC/C=C\CCCCCCCCCC1=CC(=CC(=C1)OC)O

Computed by PubChem (NCBI)