CAS 1378309-19-3 appears in our catalog under these names: Ethyl 2-(3,4-dichlorophenoxy)butanoate, 95%, Ethyl 2-(3,4-dichlorophenoxy)butanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
Ethyl 2-(3,4-dichlorophenoxy)butanoate (CAS 1378309-19-3) is a chemical compound with the molecular formula C12H14Cl2O3 and a molecular weight of 277.14 g/mol. IUPAC name: ethyl 2-(3,4-dichlorophenoxy)butanoate. InChIKey: PKOOMZHJBFIUBX-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2O3 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | ethyl 2-(3,4-dichlorophenoxy)butanoate |
| InChIKey | PKOOMZHJBFIUBX-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)OCC)OC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)