Products 1455924-92-1
CAS 1455924-92-1 is the registry number for Ethyl 3-(3,4-dichlorophenyl)-3-hydroxybutanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(3,4-dichlorophenyl)-3-hydroxybutanoate (CAS 1455924-92-1) is a chemical compound with the molecular formula C12H14Cl2O3 and a molecular weight of 277.14 g/mol. IUPAC name: ethyl 3-(3,4-dichlorophenyl)-3-hydroxybutanoate. InChIKey: OLACFGWBWBOOGA-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2O3 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | ethyl 3-(3,4-dichlorophenyl)-3-hydroxybutanoate |
| InChIKey | OLACFGWBWBOOGA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C)(C1=CC(=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)