Products 1378655-16-3

CAS 1378655-16-3 is the registry number for Methyl 4-cyclobutylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 4-cyclobutylbenzoate (CAS 1378655-16-3) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: methyl 4-cyclobutylbenzoate. InChIKey: RIIYGQLUKVISMU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O2
Molecular weight190.24 g/mol
IUPAC namemethyl 4-cyclobutylbenzoate
InChIKeyRIIYGQLUKVISMU-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)C2CCC2

Computed by PubChem (NCBI)