Products 1378831-08-3
CAS 1378831-08-3 appears in our catalog under these names: 1,3-Dimethoxy-4-methyl-2-nitrobenzene, 95%, 1,3-Dimethoxy-4-methyl-2-nitrobenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
1,3-dimethoxy-4-methyl-2-nitrobenzene (CAS 1378831-08-3) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 1,3-dimethoxy-4-methyl-2-nitrobenzene. InChIKey: YBUMBXGXYYZJJU-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 1,3-dimethoxy-4-methyl-2-nitrobenzene |
| InChIKey | YBUMBXGXYYZJJU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)OC)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)