CAS 1378881-64-1 is the registry number for 6-Chloro-1-methyl-1,2-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1378881-64-1) is a chemical compound with the molecular formula C6H5ClN4O and a molecular weight of 184.58 g/mol. IUPAC name: 6-chloro-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: ZEOTVBXCUMNWLS-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN4O |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 6-chloro-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | ZEOTVBXCUMNWLS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=O)NC(=N2)Cl |
Computed by PubChem (NCBI)