CAS 137898-13-6 appears in our catalog under these names: 2-Formyl-6-methoxyphenyl trifluoromethanesulfonate, 96%, Methanesulfonic acid, trifluoro-, 2-formyl-6-methoxyphenyl ester, 96%, 96%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-formyl-6-methoxyphenyl) trifluoromethanesulfonate (CAS 137898-13-6) is a chemical compound with the molecular formula C9H7F3O5S and a molecular weight of 284.21 g/mol. IUPAC name: (2-formyl-6-methoxyphenyl) trifluoromethanesulfonate. InChIKey: VYFPCFITTXMPKA-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O5S |
|---|---|
| Molecular weight | 284.21 g/mol |
| IUPAC name | (2-formyl-6-methoxyphenyl) trifluoromethanesulfonate |
| InChIKey | VYFPCFITTXMPKA-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1OS(=O)(=O)C(F)(F)F)C=O |
Computed by PubChem (NCBI)