CAS 750607-75-1 appears in our catalog under these names: 3-[(2,2,2-Trifluoroethoxy)sulfonyl]benzoic acid, 95%, 3-((2,2,2-Trifluoroethoxy)sulfonyl)benzoic acid, 95%, 3-((2,2,2-Trifluoroethoxy)sulfonyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 0,5g.
3-(2,2,2-trifluoroethoxysulfonyl)benzoic acid (CAS 750607-75-1) is a chemical compound with the molecular formula C9H7F3O5S and a molecular weight of 284.21 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxysulfonyl)benzoic acid. InChIKey: JLDDCGZYTNFEPA-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O5S |
|---|---|
| Molecular weight | 284.21 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxysulfonyl)benzoic acid |
| InChIKey | JLDDCGZYTNFEPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)OCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)