Products 137898-21-6

CAS 137898-21-6 is the registry number for 2'-Methoxy-2,6-dimethyl-1,1'-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-(2-methoxyphenyl)-1,3-dimethylbenzene (CAS 137898-21-6) is a chemical compound with the molecular formula C15H16O and a molecular weight of 212.29 g/mol. IUPAC name: 2-(2-methoxyphenyl)-1,3-dimethylbenzene. InChIKey: XMFRQUIHEKWODO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16O
Molecular weight212.29 g/mol
IUPAC name2-(2-methoxyphenyl)-1,3-dimethylbenzene
InChIKeyXMFRQUIHEKWODO-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C)C2=CC=CC=C2OC

Computed by PubChem (NCBI)