Products 1379303-39-5
CAS 1379303-39-5 is the registry number for 3-bromo-5-methoxy-1-methyl-1H-pyrrolo[2,3-c]pyridine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
3-bromo-5-methoxy-1-methylpyrrolo[2,3-c]pyridine (CAS 1379303-39-5) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 3-bromo-5-methoxy-1-methylpyrrolo[2,3-c]pyridine. InChIKey: TVWISHQIDQDMNI-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 3-bromo-5-methoxy-1-methylpyrrolo[2,3-c]pyridine |
| InChIKey | TVWISHQIDQDMNI-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC(=NC=C21)OC)Br |
Computed by PubChem (NCBI)