Products 1379330-72-9
CAS 1379330-72-9 is the registry number for methyl 7-bromoimidazo[1,2-a]pyridine-5-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 7-bromoimidazo[1,2-a]pyridine-5-carboxylate (CAS 1379330-72-9) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: methyl 7-bromoimidazo[1,2-a]pyridine-5-carboxylate. InChIKey: PPKLIWMFUWEYNE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | methyl 7-bromoimidazo[1,2-a]pyridine-5-carboxylate |
| InChIKey | PPKLIWMFUWEYNE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC2=NC=CN12)Br |
Computed by PubChem (NCBI)