CAS 1379352-82-5 appears in our catalog under these names: 4–Bromo–7–chloro–1–methyl–1H–indole, 4-Bromo-7-chloro-1-methyl-1H-indole 95+%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
4-bromo-7-chloro-1-methylindole (CAS 1379352-82-5) is a chemical compound with the molecular formula C9H7BrClN and a molecular weight of 244.51 g/mol. IUPAC name: 4-bromo-7-chloro-1-methylindole. InChIKey: ZRSONUFNSFDFCU-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClN |
|---|---|
| Molecular weight | 244.51 g/mol |
| IUPAC name | 4-bromo-7-chloro-1-methylindole |
| InChIKey | ZRSONUFNSFDFCU-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C(C=CC(=C21)Cl)Br |
Computed by PubChem (NCBI)