CAS 55377-26-9 appears in our catalog under these names: 6–Bromoquinoline Hydrochloride, 6-Bromoquinoline hydrochloride 97%, 6-Bromoquinoline, HCl, 97%, 97%, 6-Bromoquinoline hydrochloride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 5g, 25g.
6-bromoquinoline;hydrochloride (CAS 55377-26-9) is a chemical compound with the molecular formula C9H7BrClN and a molecular weight of 244.51 g/mol. IUPAC name: 6-bromoquinoline;hydrochloride. InChIKey: DBBDYPKQZYXQFI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClN |
|---|---|
| Molecular weight | 244.51 g/mol |
| IUPAC name | 6-bromoquinoline;hydrochloride |
| InChIKey | DBBDYPKQZYXQFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)N=C1.Cl |
Computed by PubChem (NCBI)