CAS 1379355-32-4 appears in our catalog under these names: 2-Chloro-6-(trifluoromethyl)isonicotinamide, 95%, 2-Chloro-6-(trifluoromethyl)isonicotinamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-chloro-6-(trifluoromethyl)pyridine-4-carboxamide (CAS 1379355-32-4) is a chemical compound with the molecular formula C7H4ClF3N2O and a molecular weight of 224.57 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)pyridine-4-carboxamide. InChIKey: YLIZGUREJZRSSD-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N2O |
|---|---|
| Molecular weight | 224.57 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)pyridine-4-carboxamide |
| InChIKey | YLIZGUREJZRSSD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)Cl)C(=O)N |
Computed by PubChem (NCBI)