Products 1556593-91-9
CAS 1556593-91-9 is the registry number for N-(6-Chloropyridin-2-yl)-2,2,2-trifluoroacetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-(6-chloro-2-pyridinyl)-2,2,2-trifluoroacetamide (CAS 1556593-91-9) is a chemical compound with the molecular formula C7H4ClF3N2O and a molecular weight of 224.57 g/mol. IUPAC name: N-(6-chloro-2-pyridinyl)-2,2,2-trifluoroacetamide. InChIKey: XVWBVVKZAHFYKH-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N2O |
|---|---|
| Molecular weight | 224.57 g/mol |
| IUPAC name | N-(6-chloro-2-pyridinyl)-2,2,2-trifluoroacetamide |
| InChIKey | XVWBVVKZAHFYKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)