Products 1379361-62-2

CAS 1379361-62-2 is the registry number for Methyl 4-chloro-3-fluoro-α-oxobenzeneacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(4-chloro-3-fluorophenyl)-2-oxoacetate (CAS 1379361-62-2) is a chemical compound with the molecular formula C9H6ClFO3 and a molecular weight of 216.59 g/mol. IUPAC name: methyl 2-(4-chloro-3-fluorophenyl)-2-oxoacetate. InChIKey: JNWDCTVANJUHNP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6ClFO3
Molecular weight216.59 g/mol
IUPAC namemethyl 2-(4-chloro-3-fluorophenyl)-2-oxoacetate
InChIKeyJNWDCTVANJUHNP-UHFFFAOYSA-N
SMILESCOC(=O)C(=O)C1=CC(=C(C=C1)Cl)F

Computed by PubChem (NCBI)