CAS 1379361-62-2 is the registry number for Methyl 4-chloro-3-fluoro-α-oxobenzeneacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-(4-chloro-3-fluorophenyl)-2-oxoacetate (CAS 1379361-62-2) is a chemical compound with the molecular formula C9H6ClFO3 and a molecular weight of 216.59 g/mol. IUPAC name: methyl 2-(4-chloro-3-fluorophenyl)-2-oxoacetate. InChIKey: JNWDCTVANJUHNP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO3 |
|---|---|
| Molecular weight | 216.59 g/mol |
| IUPAC name | methyl 2-(4-chloro-3-fluorophenyl)-2-oxoacetate |
| InChIKey | JNWDCTVANJUHNP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=CC(=C(C=C1)Cl)F |
Computed by PubChem (NCBI)