Products 1935076-13-3

CAS 1935076-13-3 is the registry number for 3-(2-Chloro-3-fluorophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2-chloro-3-fluorophenyl)-2-oxopropanoic acid (CAS 1935076-13-3) is a chemical compound with the molecular formula C9H6ClFO3 and a molecular weight of 216.59 g/mol. IUPAC name: 3-(2-chloro-3-fluorophenyl)-2-oxopropanoic acid. InChIKey: DQMNCTQCMREZJB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6ClFO3
Molecular weight216.59 g/mol
IUPAC name3-(2-chloro-3-fluorophenyl)-2-oxopropanoic acid
InChIKeyDQMNCTQCMREZJB-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)F)Cl)CC(=O)C(=O)O

Computed by PubChem (NCBI)