CAS 1379366-90-1 appears in our catalog under these names: 6-Bromo-4-fluoro-1,3-benzothiazole-2-thiol, 95%, 6-Bromo-4-fluoro-1,3-benzothiazole-2-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-bromo-4-fluoro-3H-1,3-benzothiazole-2-thione (CAS 1379366-90-1) is a chemical compound with the molecular formula C7H3BrFNS2 and a molecular weight of 264.1 g/mol. IUPAC name: 6-bromo-4-fluoro-3H-1,3-benzothiazole-2-thione. InChIKey: XUCKGZRNZMKIJO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNS2 |
|---|---|
| Molecular weight | 264.1 g/mol |
| IUPAC name | 6-bromo-4-fluoro-3H-1,3-benzothiazole-2-thione |
| InChIKey | XUCKGZRNZMKIJO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1F)NC(=S)S2)Br |
Computed by PubChem (NCBI)