CAS 786657-44-1 is the registry number for 4-Bromo-6-fluoro-1,3-benzothiazole-2-thiol, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-bromo-6-fluoro-3H-1,3-benzothiazole-2-thione (CAS 786657-44-1) is a chemical compound with the molecular formula C7H3BrFNS2 and a molecular weight of 264.1 g/mol. IUPAC name: 4-bromo-6-fluoro-3H-1,3-benzothiazole-2-thione. InChIKey: JIWVUUSBDYSYGH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNS2 |
|---|---|
| Molecular weight | 264.1 g/mol |
| IUPAC name | 4-bromo-6-fluoro-3H-1,3-benzothiazole-2-thione |
| InChIKey | JIWVUUSBDYSYGH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=S)N2)Br)F |
Computed by PubChem (NCBI)