Products 13794-00-8

CAS 13794-00-8 is the registry number for 3-(4-Acetamidophenoxy)propanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-acetamidophenoxy)propanoic acid (CAS 13794-00-8) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 3-(4-acetamidophenoxy)propanoic acid. InChIKey: RWTUXZCYWHPJDV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO4
Molecular weight223.22 g/mol
IUPAC name3-(4-acetamidophenoxy)propanoic acid
InChIKeyRWTUXZCYWHPJDV-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC=C(C=C1)OCCC(=O)O

Computed by PubChem (NCBI)