Products 13794-02-0
CAS 13794-02-0 appears in our catalog under these names: 3-Methyl-2-phenoxybutanoic acid, 95%, 3-Methyl-2-phenoxybutanoic acid, 3-Methyl-2-phenoxybutanoic acid 95%, 3-Methyl-2-phenoxybutanoic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 2,5g, 50mg, 100mg.
3-methyl-2-phenoxybutanoic acid (CAS 13794-02-0) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 3-methyl-2-phenoxybutanoic acid. InChIKey: SACSRILQPQYFIJ-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-methyl-2-phenoxybutanoic acid |
| InChIKey | SACSRILQPQYFIJ-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)OC1=CC=CC=C1 |
Computed by PubChem (NCBI)