CAS 1379604-69-9 is the registry number for JWH 398 N–(5–hydroxypentyl) metabolite. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.
(4-chloronaphthalen-1-yl)-[1-(5-hydroxypentyl)indol-3-yl]methanone (CAS 1379604-69-9) is a chemical compound with the molecular formula C24H22ClNO2 and a molecular weight of 391.9 g/mol. IUPAC name: (4-chloronaphthalen-1-yl)-[1-(5-hydroxypentyl)indol-3-yl]methanone. InChIKey: CYMQEAJNLISWKK-UHFFFAOYSA-N.
| Molecular formula | C24H22ClNO2 |
|---|---|
| Molecular weight | 391.9 g/mol |
| IUPAC name | (4-chloronaphthalen-1-yl)-[1-(5-hydroxypentyl)indol-3-yl]methanone |
| InChIKey | CYMQEAJNLISWKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Cl)C(=O)C3=CN(C4=CC=CC=C43)CCCCCO |
Computed by PubChem (NCBI)