CAS 1537889-06-7 appears in our catalog under these names: JWH 398 N-(4-Hydroxypentyl) Metabolite, JWH 398 N–(4–hydroxypentyl) metabolite, Jwh 398 N-(4-hydroxypentyl) metabolite-d5. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 250mg, 1mg, 10mg, 5mg, 25mg, 50mg.
(4-chloronaphthalen-1-yl)-[1-(4-hydroxypentyl)indol-3-yl]methanone (CAS 1537889-06-7) is a chemical compound with the molecular formula C24H22ClNO2 and a molecular weight of 391.9 g/mol. IUPAC name: (4-chloronaphthalen-1-yl)-[1-(4-hydroxypentyl)indol-3-yl]methanone. InChIKey: KDHNVFXZDOAZAI-UHFFFAOYSA-N.
| Molecular formula | C24H22ClNO2 |
|---|---|
| Molecular weight | 391.9 g/mol |
| IUPAC name | (4-chloronaphthalen-1-yl)-[1-(4-hydroxypentyl)indol-3-yl]methanone |
| InChIKey | KDHNVFXZDOAZAI-UHFFFAOYSA-N |
| SMILES | CC(CCCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=C(C4=CC=CC=C43)Cl)O |
Computed by PubChem (NCBI)