CAS 1379811-73-0 appears in our catalog under these names: [2-(4-tert-Butylphenoxy)-1-cyclopropylethyl]amine hydrochloride, 95%, 2-(4-(tert-Butyl)phenoxy)-1-cyclopropylethanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-(4-tert-butylphenoxy)-1-cyclopropylethanamine;hydrochloride (CAS 1379811-73-0) is a chemical compound with the molecular formula C15H24ClNO and a molecular weight of 269.81 g/mol. IUPAC name: 2-(4-tert-butylphenoxy)-1-cyclopropylethanamine;hydrochloride. InChIKey: HDSOZKOUGKXLGI-UHFFFAOYSA-N.
| Molecular formula | C15H24ClNO |
|---|---|
| Molecular weight | 269.81 g/mol |
| IUPAC name | 2-(4-tert-butylphenoxy)-1-cyclopropylethanamine;hydrochloride |
| InChIKey | HDSOZKOUGKXLGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OCC(C2CC2)N.Cl |
Computed by PubChem (NCBI)