CAS 2760568-91-8 is the registry number for rel-2-Isopropyl-4-((2S,5R)-5-methylpiperidin-2-yl)phenol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2S,5R)-5-methylpiperidin-2-yl]-2-propan-2-ylphenol;hydrochloride (CAS 2760568-91-8) is a chemical compound with the molecular formula C15H24ClNO and a molecular weight of 269.81 g/mol. IUPAC name: 4-[(2S,5R)-5-methylpiperidin-2-yl]-2-propan-2-ylphenol;hydrochloride. InChIKey: CAZNAVPCNBUSSL-GGMFNZDASA-N.
| Molecular formula | C15H24ClNO |
|---|---|
| Molecular weight | 269.81 g/mol |
| IUPAC name | 4-[(2S,5R)-5-methylpiperidin-2-yl]-2-propan-2-ylphenol;hydrochloride |
| InChIKey | CAZNAVPCNBUSSL-GGMFNZDASA-N |
| SMILES | C[C@@H]1CC[C@H](NC1)C2=CC(=C(C=C2)O)C(C)C.Cl |
Computed by PubChem (NCBI)