CAS 137987-94-1 is the registry number for 3-(4-Chlorophenoxy)-7-hydroxy-4H-chromen-4-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-(4-chlorophenoxy)-7-hydroxychromen-4-one (CAS 137987-94-1) is a chemical compound with the molecular formula C15H9ClO4 and a molecular weight of 288.68 g/mol. IUPAC name: 3-(4-chlorophenoxy)-7-hydroxychromen-4-one. InChIKey: BIWKGGSODHYGIP-UHFFFAOYSA-N.
| Molecular formula | C15H9ClO4 |
|---|---|
| Molecular weight | 288.68 g/mol |
| IUPAC name | 3-(4-chlorophenoxy)-7-hydroxychromen-4-one |
| InChIKey | BIWKGGSODHYGIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=COC3=C(C2=O)C=CC(=C3)O)Cl |
Computed by PubChem (NCBI)