Products 1459704-68-7
CAS 1459704-68-7 is the registry number for PfFAS-II inhibitor 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(4-chloro-2-hydroxyphenoxy)chromen-2-one (CAS 1459704-68-7) is a chemical compound with the molecular formula C15H9ClO4 and a molecular weight of 288.68 g/mol. IUPAC name: 6-(4-chloro-2-hydroxyphenoxy)chromen-2-one. InChIKey: AEHMYKKZFUJGLO-UHFFFAOYSA-N.
| Molecular formula | C15H9ClO4 |
|---|---|
| Molecular weight | 288.68 g/mol |
| IUPAC name | 6-(4-chloro-2-hydroxyphenoxy)chromen-2-one |
| InChIKey | AEHMYKKZFUJGLO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1OC3=C(C=C(C=C3)Cl)O |
Computed by PubChem (NCBI)