CAS 138-84-1 appears in our catalog under these names: 4-Aminobenzoate potassium salt, 98%, 4–Aminobenzoic acid potassium salt, Aminobenzoate potassium 99+%, 4-AMINOBENZOIC ACID POTASSIUM SALT, 97%, potassium 4-aminobenzoate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 100g, 500g, 5g, 1000g, 10 g, 5 g, 25 g.
Potassium 4-aminobenzoate (CAS 138-84-1) is a chemical compound with the molecular formula C7H6KNO2 and a molecular weight of 175.23 g/mol. IUPAC name: potassium 4-aminobenzoate. InChIKey: MZKKJVZIFIQOPP-UHFFFAOYSA-M.
| Molecular formula | C7H6KNO2 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | potassium 4-aminobenzoate |
| InChIKey | MZKKJVZIFIQOPP-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(=O)[O-])N.[K+] |
Computed by PubChem (NCBI)