CAS 32685-16-8 appears in our catalog under these names: Potassium (phenylformamido)olate, 95%, Benzohydroxamic acid potassium. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g, 50g, 100g, 250g.
Potassium N-oxidobenzamide (CAS 32685-16-8) is a chemical compound with the molecular formula C7H6KNO2 and a molecular weight of 175.23 g/mol. IUPAC name: potassium N-oxidobenzamide. InChIKey: KNALIXDZFLAJJD-UHFFFAOYSA-N.
| Molecular formula | C7H6KNO2 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | potassium N-oxidobenzamide |
| InChIKey | KNALIXDZFLAJJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[O-].[K+] |
Computed by PubChem (NCBI)