CAS 1380049-42-2 appears in our catalog under these names: 2-(3-Formyl-4-isobutoxyphenyl)-N,N,4-trimethylthiazole-5-carboxamide, 98%, Febuxostat Impurity 126. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[3-formyl-4-(2-methylpropoxy)phenyl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (CAS 1380049-42-2) is a chemical compound with the molecular formula C18H22N2O3S and a molecular weight of 346.4 g/mol. IUPAC name: 2-[3-formyl-4-(2-methylpropoxy)phenyl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide. InChIKey: QTUURZAFIAGQRN-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O3S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2-[3-formyl-4-(2-methylpropoxy)phenyl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| InChIKey | QTUURZAFIAGQRN-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)OCC(C)C)C=O)C(=O)N(C)C |
Computed by PubChem (NCBI)