CAS 2731709-58-1 is the registry number for Oxomemazine N-Oxide. Offered by: TRC. Available pack sizes: 10mg.
3-(5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine oxide (CAS 2731709-58-1) is a chemical compound with the molecular formula C18H22N2O3S and a molecular weight of 346.4 g/mol. IUPAC name: 3-(5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine oxide. InChIKey: WEBKISOKFNYDNR-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O3S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 3-(5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine oxide |
| InChIKey | WEBKISOKFNYDNR-UHFFFAOYSA-N |
| SMILES | CC(CN1C2=CC=CC=C2S(=O)(=O)C3=CC=CC=C31)C[N+](C)(C)[O-] |
Computed by PubChem (NCBI)