CAS 1380089-81-5 appears in our catalog under these names: CPI-0610 carboxylic acid/ 98.62% (existing batch purity), CPI-0610 carboxylic acid. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 5 mg, 10 mg, 1 mg.
2-[(4S)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetic acid (CAS 1380089-81-5) is a chemical compound with the molecular formula C20H15ClN2O3 and a molecular weight of 366.8 g/mol. IUPAC name: 2-[(4S)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetic acid. InChIKey: DBLBPRFLLZXMOW-INIZCTEOSA-N.
| Molecular formula | C20H15ClN2O3 |
|---|---|
| Molecular weight | 366.8 g/mol |
| IUPAC name | 2-[(4S)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetic acid |
| InChIKey | DBLBPRFLLZXMOW-INIZCTEOSA-N |
| SMILES | CC1=NOC2=C1C3=CC=CC=C3C(=N[C@H]2CC(=O)O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)