CAS 13558-31-1 appears in our catalog under these names: Rhodamine 110 chloride, 1 g, Rhodamine 110, Rhodamine 110/ 98.6% (existing batch purity), Rhodamine 110 (Rhodamine 110 chloride), Rhodamine 110 chloride, 97.00%. Offered by: Roth, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg, 50mg, 0,5g, 2.5g, 500MG, 2g.
2-(3-amino-6-iminoxanthen-9-yl)benzoic acid;hydrochloride (CAS 13558-31-1) is a chemical compound with the molecular formula C20H15ClN2O3 and a molecular weight of 366.8 g/mol. IUPAC name: 2-(3-amino-6-iminoxanthen-9-yl)benzoic acid;hydrochloride. InChIKey: JNGRENQDBKMCCR-UHFFFAOYSA-N.
| Molecular formula | C20H15ClN2O3 |
|---|---|
| Molecular weight | 366.8 g/mol |
| IUPAC name | 2-(3-amino-6-iminoxanthen-9-yl)benzoic acid;hydrochloride |
| InChIKey | JNGRENQDBKMCCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C3C=CC(=N)C=C3OC4=C2C=CC(=C4)N)C(=O)O.Cl |
Computed by PubChem (NCBI)