CAS 1380202-39-0 appears in our catalog under these names: 2–(2–chlorophenyl)–2,2–difluoroethan–1–ol, 2-(2-chlorophenyl)-2,2-difluoroethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.
2-(2-chlorophenyl)-2,2-difluoroethanol (CAS 1380202-39-0) is a chemical compound with the molecular formula C8H7ClF2O and a molecular weight of 192.59 g/mol. IUPAC name: 2-(2-chlorophenyl)-2,2-difluoroethanol. InChIKey: RBFOBWKGRFPAQH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2O |
|---|---|
| Molecular weight | 192.59 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-2,2-difluoroethanol |
| InChIKey | RBFOBWKGRFPAQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CO)(F)F)Cl |
Computed by PubChem (NCBI)