Products 1380310-97-3
CAS 1380310-97-3 appears in our catalog under these names: 7-(3-Fluorobenzyl)-4-chloro-7h-pyrrolo[2,3-d]pyrimidine, 95%, 4-Chloro-7-(3-fluorobenzyl)-7H-pyrrolo(2,3-d)pyrimidine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
4-chloro-7-[(3-fluorophenyl)methyl]pyrrolo[2,3-d]pyrimidine (CAS 1380310-97-3) is a chemical compound with the molecular formula C13H9ClFN3 and a molecular weight of 261.68 g/mol. IUPAC name: 4-chloro-7-[(3-fluorophenyl)methyl]pyrrolo[2,3-d]pyrimidine. InChIKey: MGBJKPXWPRCLBE-UHFFFAOYSA-N.
| Molecular formula | C13H9ClFN3 |
|---|---|
| Molecular weight | 261.68 g/mol |
| IUPAC name | 4-chloro-7-[(3-fluorophenyl)methyl]pyrrolo[2,3-d]pyrimidine |
| InChIKey | MGBJKPXWPRCLBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CN2C=CC3=C2N=CN=C3Cl |
Computed by PubChem (NCBI)