Products 866050-57-9
CAS 866050-57-9 appears in our catalog under these names: 5-Chloro-2-(4-fluorophenyl)-7-methylimidazo[1,2-a]pyrimidine, 95%, 95%, 5-Chloro-2-(4-fluorophenyl)-7-methylimidazo[1,2-a]pyrimidine, 90%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2-(4-fluorophenyl)-7-methylimidazo[1,2-a]pyrimidine (CAS 866050-57-9) is a chemical compound with the molecular formula C13H9ClFN3 and a molecular weight of 261.68 g/mol. IUPAC name: 5-chloro-2-(4-fluorophenyl)-7-methylimidazo[1,2-a]pyrimidine. InChIKey: YPTYZPXDPHMJPA-UHFFFAOYSA-N.
| Molecular formula | C13H9ClFN3 |
|---|---|
| Molecular weight | 261.68 g/mol |
| IUPAC name | 5-chloro-2-(4-fluorophenyl)-7-methylimidazo[1,2-a]pyrimidine |
| InChIKey | YPTYZPXDPHMJPA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=CN2C(=C1)Cl)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)