Products 138039-33-5
CAS 138039-33-5 is the registry number for Leptosphaerodione. Offered by: MedChemExpress. Available pack sizes: Get quote.
10-hydroxy-7-methoxy-3-[(E)-4-methylhex-2-en-2-yl]-1H-benzo[g]isochromene-8,9-dione (CAS 138039-33-5) is a chemical compound with the molecular formula C21H22O5 and a molecular weight of 354.4 g/mol. IUPAC name: 10-hydroxy-7-methoxy-3-[(E)-4-methylhex-2-en-2-yl]-1H-benzo[g]isochromene-8,9-dione. InChIKey: YIEXBFWEBRLCNL-WUXMJOGZSA-N.
| Molecular formula | C21H22O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 10-hydroxy-7-methoxy-3-[(E)-4-methylhex-2-en-2-yl]-1H-benzo[g]isochromene-8,9-dione |
| InChIKey | YIEXBFWEBRLCNL-WUXMJOGZSA-N |
| SMILES | CCC(C)/C=C(\C)/C1=CC2=C(CO1)C(=C3C(=C2)C=C(C(=O)C3=O)OC)O |
Computed by PubChem (NCBI)
Synonyms:
Leptosphaerodione, orb1981948