CAS 1380442-19-2 is the registry number for (R)-4-((tert-Butyldiphenylsilyl)oxy)-2,3-dimethylbutan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-dimethylbutan-2-ol (CAS 1380442-19-2) is a chemical compound with the molecular formula C22H32O2Si and a molecular weight of 356.6 g/mol. IUPAC name: (3R)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-dimethylbutan-2-ol. InChIKey: TXQSBYAVQNZHSM-GOSISDBHSA-N.
| Molecular formula | C22H32O2Si |
|---|---|
| Molecular weight | 356.6 g/mol |
| IUPAC name | (3R)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-dimethylbutan-2-ol |
| InChIKey | TXQSBYAVQNZHSM-GOSISDBHSA-N |
| SMILES | C[C@H](CO[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C(C)(C)C)C(C)(C)O |
Computed by PubChem (NCBI)