CAS 439693-30-8 appears in our catalog under these names: 4–((Tert–Butyldiphenylsilyl)Oxy)–2,2–Dimethylbutan–1–Ol, 4-((Tert-Butyldiphenylsilyl)Oxy)-2,2-Dimethylbutan-1-Ol, 95%, 95%, 4-((TERT-BUTYLDIPHENYLSILYL)OXY)-2,2-DIMETHYLBUTAN-1-OL, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutan-1-ol (CAS 439693-30-8) is a chemical compound with the molecular formula C22H32O2Si and a molecular weight of 356.6 g/mol. IUPAC name: 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutan-1-ol. InChIKey: DASDLTDKOPBSIO-UHFFFAOYSA-N.
| Molecular formula | C22H32O2Si |
|---|---|
| Molecular weight | 356.6 g/mol |
| IUPAC name | 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutan-1-ol |
| InChIKey | DASDLTDKOPBSIO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCC(C)(C)CO |
Computed by PubChem (NCBI)