CAS 1380511-98-7 is the registry number for (E)-4-(2-Bromo-5-methoxyphenyl)but-3-enoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-(2-bromo-5-methoxyphenyl)but-3-enoyl fluoride (CAS 1380511-98-7) is a chemical compound with the molecular formula C11H10BrFO2 and a molecular weight of 273.10 g/mol. IUPAC name: (E)-4-(2-bromo-5-methoxyphenyl)but-3-enoyl fluoride. InChIKey: UTJIARNOVHBRQI-NSCUHMNNSA-N.
| Molecular formula | C11H10BrFO2 |
|---|---|
| Molecular weight | 273.10 g/mol |
| IUPAC name | (E)-4-(2-bromo-5-methoxyphenyl)but-3-enoyl fluoride |
| InChIKey | UTJIARNOVHBRQI-NSCUHMNNSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)/C=C/CC(=O)F |
Computed by PubChem (NCBI)