Products 1620318-27-5
CAS 1620318-27-5 is the registry number for Methyl 1-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 1-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylate (CAS 1620318-27-5) is a chemical compound with the molecular formula C11H10BrFO2 and a molecular weight of 273.10 g/mol. IUPAC name: methyl 1-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylate. InChIKey: JXKLZKBJHDSCHN-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO2 |
|---|---|
| Molecular weight | 273.10 g/mol |
| IUPAC name | methyl 1-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylate |
| InChIKey | JXKLZKBJHDSCHN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC1)C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)