Products 1380540-77-1
CAS 1380540-77-1 is the registry number for 2-(4-Hydroxy-2-oxoindolin-3-yl)acetonitrile. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
2-(4-hydroxy-2-oxo-1,3-dihydroindol-3-yl)acetonitrile (CAS 1380540-77-1) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 2-(4-hydroxy-2-oxo-1,3-dihydroindol-3-yl)acetonitrile. InChIKey: KJLUDHCNWCIINR-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-(4-hydroxy-2-oxo-1,3-dihydroindol-3-yl)acetonitrile |
| InChIKey | KJLUDHCNWCIINR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(C(=O)N2)CC#N)C(=C1)O |
Computed by PubChem (NCBI)