CAS 13807-10-8 is the registry number for (4-Amino-2-(phenylamino)thiazol-5-yl)(phenyl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-amino-2-anilino-1,3-thiazol-5-yl)-phenylmethanone (CAS 13807-10-8) is a chemical compound with the molecular formula C16H13N3OS and a molecular weight of 295.4 g/mol. IUPAC name: (4-amino-2-anilino-1,3-thiazol-5-yl)-phenylmethanone. InChIKey: YOZXSIIEHFGLLO-UHFFFAOYSA-N.
| Molecular formula | C16H13N3OS |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | (4-amino-2-anilino-1,3-thiazol-5-yl)-phenylmethanone |
| InChIKey | YOZXSIIEHFGLLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(N=C(S2)NC3=CC=CC=C3)N |
Computed by PubChem (NCBI)